C32H24N6O9 — CID 126579739
N-[[1-[2-[4-(3-hydroxy-6-oxoxanthen-9-yl)-3-methylphenoxy]ethyl]triazol-4-yl]methyl]-3,5-dinitrobenzamide (PubChem CID 126579739) has the molecular formula C32H24N6O9 and a molecular weight of 636.58 g/mol. Its IUPAC name is N-[[1-[2-[4-(3-hydroxy-6-oxoxanthen-9-yl)-3-methylphenoxy]ethyl]triazol-4-yl]methyl]-3,5-dinitrobenzamide.
| Compound Name | N-[[1-[2-[4-(3-hydroxy-6-oxoxanthen-9-yl)-3-methylphenoxy]ethyl]triazol-4-yl]methyl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 126579739 |
| Molecular Formula | C32H24N6O9 |
| Molecular Weight | 636.58 g/mol |
| Exact Mass | 636.16 |
| IUPAC Name | N-[[1-[2-[4-(3-hydroxy-6-oxoxanthen-9-yl)-3-methylphenoxy]ethyl]triazol-4-yl]methyl]-3,5-dinitrobenzamide |
| SMILES | Cc1cc(OCCn2cc(CNC(=O)c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)nn2)ccc1-c1c2ccc(=O)cc-2oc2cc(O)ccc12 |
| InChI | InChI=1S/C32H24N6O9/c1-18-10-25(4-7-26(18)31-27-5-2-23(39)14-29(27)47-30-15-24(40)3-6-28(30)31)46-9-8-36-17-20(34-35-36)16-33-32(41)19-11-21(37(42)43)13-22(12-19)38(44)45/h2-7,10-15,17,39H,8-9,16H2,1H3,(H,33,41) |
| InChIKey | YPIKQDLRFOFLBV-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 205.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.58 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|