C35H46N4O4S+2 — CID 58352476
4-[2-[2-[dimethyl-[2-(trimethylazaniumyl)ethyl]azaniumyl]ethyl-dimethylazaniumyl]ethylcarbamothioyl]-2-(3-methyl-6-oxoxanthen-9-yl)benzoate (PubChem CID 58352476) has the molecular formula C35H46N4O4S+2 and a molecular weight of 618.84 g/mol. Its IUPAC name is 4-[2-[2-[dimethyl-[2-(trimethylazaniumyl)ethyl]azaniumyl]ethyl-dimethylazaniumyl]ethylcarbamothioyl]-2-(3-methyl-6-oxoxanthen-9-yl)benzoate.
| Compound Name | 4-[2-[2-[dimethyl-[2-(trimethylazaniumyl)ethyl]azaniumyl]ethyl-dimethylazaniumyl]ethylcarbamothioyl]-2-(3-methyl-6-oxoxanthen-9-yl)benzoate |
|---|---|
| PubChem CID | 58352476 |
| Molecular Formula | C35H46N4O4S+2 |
| Molecular Weight | 618.84 g/mol |
| Exact Mass | 618.32 |
| IUPAC Name | 4-[2-[2-[dimethyl-[2-(trimethylazaniumyl)ethyl]azaniumyl]ethyl-dimethylazaniumyl]ethylcarbamothioyl]-2-(3-methyl-6-oxoxanthen-9-yl)benzoate |
| SMILES | Cc1ccc2c(-c3cc(C(=S)NCC[N+](C)(C)CC[N+](C)(C)CC[N+](C)(C)C)ccc3C(=O)[O-])c3ccc(=O)cc-3oc2c1 |
| InChI | InChI=1S/C35H45N4O4S/c1-24-9-12-28-31(21-24)43-32-23-26(40)11-14-29(32)33(28)30-22-25(10-13-27(30)35(41)42)34(44)36-15-16-38(5,6)19-20-39(7,8)18-17-37(2,3)4/h9-14,21-23H,15-20H2,1-8H3/q+1/p+1 |
| InChIKey | APECPTCMTYIMFY-UHFFFAOYSA-O |
| XLogP | 3.36 |
| TPSA | 82.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.84 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|