C53H36N2O10-2 — CID 159237232
4-aminocyclohexa-2,5-dien-1-one;2-[3-(4-aminophenoxy)-6-oxoxanthen-9-yl]benzoate;2-(3-methyl-6-oxoxanthen-9-yl)benzoate (PubChem CID 159237232) has the molecular formula C53H36N2O10-2 and a molecular weight of 860.88 g/mol. Its IUPAC name is 4-aminocyclohexa-2,5-dien-1-one;2-[3-(4-aminophenoxy)-6-oxoxanthen-9-yl]benzoate;2-(3-methyl-6-oxoxanthen-9-yl)benzoate.
| Compound Name | 4-aminocyclohexa-2,5-dien-1-one;2-[3-(4-aminophenoxy)-6-oxoxanthen-9-yl]benzoate;2-(3-methyl-6-oxoxanthen-9-yl)benzoate |
|---|---|
| PubChem CID | 159237232 |
| Molecular Formula | C53H36N2O10-2 |
| Molecular Weight | 860.88 g/mol |
| Exact Mass | 860.24 |
| IUPAC Name | 4-aminocyclohexa-2,5-dien-1-one;2-[3-(4-aminophenoxy)-6-oxoxanthen-9-yl]benzoate;2-(3-methyl-6-oxoxanthen-9-yl)benzoate |
| SMILES | Cc1ccc2c(-c3ccccc3C(=O)[O-])c3ccc(=O)cc-3oc2c1.NC1C=CC(=O)C=C1.Nc1ccc(Oc2ccc3c(-c4ccccc4C(=O)[O-])c4ccc(=O)cc-4oc3c2)cc1 |
| InChI | InChI=1S/C26H17NO5.C21H14O4.C6H7NO/c27-15-5-8-17(9-6-15)31-18-10-12-22-24(14-18)32-23-13-16(28)7-11-21(23)25(22)19-3-1-2-4-20(19)26(29)30;1-12-6-8-16-18(10-12)25-19-11-13(22)7-9-17(19)20(16)14-4-2-3-5-15(14)21(23)24;7-5-1-3-6(8)4-2-5/h1-14H,27H2,(H,29,30);2-11H,1H3,(H,23,24);1-5H,7H2/p-2 |
| InChIKey | KTQBLVOAMXZBPB-UHFFFAOYSA-L |
| XLogP | 7.55 |
| TPSA | 219.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 65 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 860.88 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|