C24H15NO6 — CID 88578532
[2-(3-hydroxy-6-oxoxanthen-9-yl)-4-(prop-2-ynylcarbamoyl)phenyl] formate (PubChem CID 88578532) has the molecular formula C24H15NO6 and a molecular weight of 413.39 g/mol. Its IUPAC name is [2-(3-hydroxy-6-oxoxanthen-9-yl)-4-(prop-2-ynylcarbamoyl)phenyl] formate.
| Compound Name | [2-(3-hydroxy-6-oxoxanthen-9-yl)-4-(prop-2-ynylcarbamoyl)phenyl] formate |
|---|---|
| PubChem CID | 88578532 |
| Molecular Formula | C24H15NO6 |
| Molecular Weight | 413.39 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | [2-(3-hydroxy-6-oxoxanthen-9-yl)-4-(prop-2-ynylcarbamoyl)phenyl] formate |
| SMILES | C#CCNC(=O)c1ccc(OC=O)c(-c2c3ccc(=O)cc-3oc3cc(O)ccc23)c1 |
| InChI | InChI=1S/C24H15NO6/c1-2-9-25-24(29)14-3-8-20(30-13-26)19(10-14)23-17-6-4-15(27)11-21(17)31-22-12-16(28)5-7-18(22)23/h1,3-8,10-13,27H,9H2,(H,25,29) |
| InChIKey | YFCNDGQNUBXSSM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|