C28H19BN2O8 — CID 89141435
5-[[(E)-(2-boronophenyl)methylideneamino]carbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid (PubChem CID 89141435) has the molecular formula C28H19BN2O8 and a molecular weight of 522.28 g/mol. Its IUPAC name is 5-[[(E)-(2-boronophenyl)methylideneamino]carbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid.
| Compound Name | 5-[[(E)-(2-boronophenyl)methylideneamino]carbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 89141435 |
| Molecular Formula | C28H19BN2O8 |
| Molecular Weight | 522.28 g/mol |
| Exact Mass | 522.12 |
| IUPAC Name | 5-[[(E)-(2-boronophenyl)methylideneamino]carbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
| SMILES | O=C(N/N=C/c1ccccc1B(O)O)c1ccc(-c2c3ccc(=O)cc-3oc3cc(O)ccc23)c(C(=O)O)c1 |
| InChI | InChI=1S/C28H19BN2O8/c32-17-6-9-20-24(12-17)39-25-13-18(33)7-10-21(25)26(20)19-8-5-15(11-22(19)28(35)36)27(34)31-30-14-16-3-1-2-4-23(16)29(37)38/h1-14,32,37-38H,(H,31,34)(H,35,36)/b30-14+ |
| InChIKey | QPUVSPLLDGZINH-AMVVHIIESA-N |
| XLogP | 2.41 |
| TPSA | 169.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.28 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|