C21H16O5 — CID 134533555
(2E,3Z)-2-ethylidene-3-(3-hydroxy-6-oxoxanthen-9-yl)hexa-3,5-dienoic acid (PubChem CID 134533555) has the molecular formula C21H16O5 and a molecular weight of 348.35 g/mol. Its IUPAC name is (2E,3Z)-2-ethylidene-3-(3-hydroxy-6-oxoxanthen-9-yl)hexa-3,5-dienoic acid.
| Compound Name | (2E,3Z)-2-ethylidene-3-(3-hydroxy-6-oxoxanthen-9-yl)hexa-3,5-dienoic acid |
|---|---|
| PubChem CID | 134533555 |
| Molecular Formula | C21H16O5 |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | (2E,3Z)-2-ethylidene-3-(3-hydroxy-6-oxoxanthen-9-yl)hexa-3,5-dienoic acid |
| SMILES | C=C/C=C(C(=C/C)\C(=O)O)/c1c2ccc(=O)cc-2oc2cc(O)ccc12 |
| InChI | InChI=1S/C21H16O5/c1-3-5-15(14(4-2)21(24)25)20-16-8-6-12(22)10-18(16)26-19-11-13(23)7-9-17(19)20/h3-11,22H,1H2,2H3,(H,24,25)/b14-4+,15-5+ |
| InChIKey | JRZLKUZEGAZXPR-VHUAAIQRSA-N |
| XLogP | 4.20 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|