C22H18F6N2O — CID 142297492
9-[(3E)-penta-1,3-dien-3-yl]-N-(2,2,2-trifluoroethyl)-6-(2,2,2-trifluoroethylimino)xanthen-3-amine (PubChem CID 142297492) has the molecular formula C22H18F6N2O and a molecular weight of 440.39 g/mol. Its IUPAC name is 9-[(3E)-penta-1,3-dien-3-yl]-N-(2,2,2-trifluoroethyl)-6-(2,2,2-trifluoroethylimino)xanthen-3-amine.
| Compound Name | 9-[(3E)-penta-1,3-dien-3-yl]-N-(2,2,2-trifluoroethyl)-6-(2,2,2-trifluoroethylimino)xanthen-3-amine |
|---|---|
| PubChem CID | 142297492 |
| Molecular Formula | C22H18F6N2O |
| Molecular Weight | 440.39 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | 9-[(3E)-penta-1,3-dien-3-yl]-N-(2,2,2-trifluoroethyl)-6-(2,2,2-trifluoroethylimino)xanthen-3-amine |
| SMILES | C=C/C(=C\C)c1c2cc/c(=N\CC(F)(F)F)cc-2oc2cc(NCC(F)(F)F)ccc12 |
| InChI | InChI=1S/C22H18F6N2O/c1-3-13(4-2)20-16-7-5-14(29-11-21(23,24)25)9-18(16)31-19-10-15(6-8-17(19)20)30-12-22(26,27)28/h3-10,29H,1,11-12H2,2H3/b13-4+,30-15+ |
| InChIKey | VATYTKUAFFSEJA-OZXLATRGSA-N |
| XLogP | 6.56 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.39 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|