C34H42FN6O8PS2 — CID 46877569
2-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]-5-[[1-[3-[fluoro(methoxy)phosphoryl]propyl]triazol-4-yl]methylsulfamoyl]benzenesulfonate (PubChem CID 46877569) has the molecular formula C34H42FN6O8PS2 and a molecular weight of 776.85 g/mol. Its IUPAC name is 2-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]-5-[[1-[3-[fluoro(methoxy)phosphoryl]propyl]triazol-4-yl]methylsulfamoyl]benzenesulfonate.
| Compound Name | 2-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]-5-[[1-[3-[fluoro(methoxy)phosphoryl]propyl]triazol-4-yl]methylsulfamoyl]benzenesulfonate |
|---|---|
| PubChem CID | 46877569 |
| Molecular Formula | C34H42FN6O8PS2 |
| Molecular Weight | 776.85 g/mol |
| Exact Mass | 776.22 |
| IUPAC Name | 2-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]-5-[[1-[3-[fluoro(methoxy)phosphoryl]propyl]triazol-4-yl]methylsulfamoyl]benzenesulfonate |
| SMILES | CCN(CC)c1ccc2c(-c3ccc(S(=O)(=O)NCc4cn(CCCP(=O)(F)OC)nn4)cc3S(=O)(=O)[O-])c3ccc(=[N+](CC)CC)cc-3oc2c1 |
| InChI | InChI=1S/C34H42FN6O8PS2/c1-6-39(7-2)25-11-14-28-31(19-25)49-32-20-26(40(8-3)9-4)12-15-29(32)34(28)30-16-13-27(21-33(30)52(45,46)47)51(43,44)36-22-24-23-41(38-37-24)17-10-18-50(35,42)48-5/h11-16,19-21,23,36H,6-10,17-18,22H2,1-5H3 |
| InChIKey | QNPXCGVLMMGITL-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 179.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.85 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|