C42H60N5O10SSi- — CID 157178336
[6-(diethylamino)-9-[2-[4-(3-triethoxysilylpropylcarbamoyl)piperazine-1-carbonyl]phenyl]xanthen-3-ylidene]-diethylazanium;oxido sulfite (PubChem CID 157178336) has the molecular formula C42H60N5O10SSi- and a molecular weight of 855.12 g/mol. Its IUPAC name is [6-(diethylamino)-9-[2-[4-(3-triethoxysilylpropylcarbamoyl)piperazine-1-carbonyl]phenyl]xanthen-3-ylidene]-diethylazanium;oxido sulfite.
| Compound Name | [6-(diethylamino)-9-[2-[4-(3-triethoxysilylpropylcarbamoyl)piperazine-1-carbonyl]phenyl]xanthen-3-ylidene]-diethylazanium;oxido sulfite |
|---|---|
| PubChem CID | 157178336 |
| Molecular Formula | C42H60N5O10SSi- |
| Molecular Weight | 855.12 g/mol |
| Exact Mass | 854.38 |
| IUPAC Name | [6-(diethylamino)-9-[2-[4-(3-triethoxysilylpropylcarbamoyl)piperazine-1-carbonyl]phenyl]xanthen-3-ylidene]-diethylazanium;oxido sulfite |
| SMILES | CCO[Si](CCCNC(=O)N1CCN(C(=O)c2ccccc2-c2c3ccc(=[N+](CC)CC)cc-3oc3cc(N(CC)CC)ccc23)CC1)(OCC)OCC.O=S([O-])O[O-] |
| InChI | InChI=1S/C42H59N5O6Si.H2O4S/c1-8-44(9-2)32-20-22-36-38(30-32)53-39-31-33(45(10-3)11-4)21-23-37(39)40(36)34-18-15-16-19-35(34)41(48)46-25-27-47(28-26-46)42(49)43-24-17-29-54(50-12-5,51-13-6)52-14-7;1-4-5(2)3/h15-16,18-23,30-31H,8-14,17,24-29H2,1-7H3;1H,(H,2,3)/p-1 |
| InChIKey | DXPRGDOCEDCUGG-UHFFFAOYSA-M |
| XLogP | 4.84 |
| TPSA | 172.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.12 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|