C40H50N2O5 — CID 58927021
methyl 7-[decyl(hexyl)amino]-3-(4,8-dimethylbenzo[e][1,3]benzoxazol-2-yl)-2-oxochromene-4-carboxylate (PubChem CID 58927021) has the molecular formula C40H50N2O5 and a molecular weight of 638.85 g/mol. Its IUPAC name is methyl 7-[decyl(hexyl)amino]-3-(4,8-dimethylbenzo[e][1,3]benzoxazol-2-yl)-2-oxochromene-4-carboxylate.
| Compound Name | methyl 7-[decyl(hexyl)amino]-3-(4,8-dimethylbenzo[e][1,3]benzoxazol-2-yl)-2-oxochromene-4-carboxylate |
|---|---|
| PubChem CID | 58927021 |
| Molecular Formula | C40H50N2O5 |
| Molecular Weight | 638.85 g/mol |
| Exact Mass | 638.37 |
| IUPAC Name | methyl 7-[decyl(hexyl)amino]-3-(4,8-dimethylbenzo[e][1,3]benzoxazol-2-yl)-2-oxochromene-4-carboxylate |
| SMILES | CCCCCCCCCCN(CCCCCC)c1ccc2c(C(=O)OC)c(-c3nc4c(o3)c(C)cc3ccc(C)cc34)c(=O)oc2c1 |
| InChI | InChI=1S/C40H50N2O5/c1-6-8-10-12-13-14-15-17-23-42(22-16-11-9-7-2)30-20-21-31-33(26-30)46-40(44)35(34(31)39(43)45-5)38-41-36-32-24-27(3)18-19-29(32)25-28(4)37(36)47-38/h18-21,24-26H,6-17,22-23H2,1-5H3 |
| InChIKey | ZOCRURXGFXHVQP-UHFFFAOYSA-N |
| XLogP | 10.69 |
| TPSA | 85.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.85 |
| LogP ≤ 5 | 10.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|