C24H21N3O4 — CID 71653878
3-[2-(dimethylamino)ethyl]-12-(2-methoxyphenyl)-11-oxa-3,13-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-1(15),5,7,9(16),10(14),12-hexaene-2,4-dione (PubChem CID 71653878) has the molecular formula C24H21N3O4 and a molecular weight of 415.45 g/mol. Its IUPAC name is 3-[2-(dimethylamino)ethyl]-12-(2-methoxyphenyl)-11-oxa-3,13-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-1(15),5,7,9(16),10(14),12-hexaene-2,4-dione.
| Compound Name | 3-[2-(dimethylamino)ethyl]-12-(2-methoxyphenyl)-11-oxa-3,13-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-1(15),5,7,9(16),10(14),12-hexaene-2,4-dione |
|---|---|
| PubChem CID | 71653878 |
| Molecular Formula | C24H21N3O4 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 3-[2-(dimethylamino)ethyl]-12-(2-methoxyphenyl)-11-oxa-3,13-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-1(15),5,7,9(16),10(14),12-hexaene-2,4-dione |
| SMILES | COc1ccccc1-c1nc2cc3c4c(cccc4c2o1)C(=O)N(CCN(C)C)C3=O |
| InChI | InChI=1S/C24H21N3O4/c1-26(2)11-12-27-23(28)16-9-6-8-15-20(16)17(24(27)29)13-18-21(15)31-22(25-18)14-7-4-5-10-19(14)30-3/h4-10,13H,11-12H2,1-3H3 |
| InChIKey | LFFQVFYTPSBIOI-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 75.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|