C29H33N3O4 — CID 129137926
2-[[2-(2-methyl-3-phenylphenyl)-6-(2-morpholin-4-ylethoxy)-1,3-benzoxazol-5-yl]methylamino]ethanol (PubChem CID 129137926) has the molecular formula C29H33N3O4 and a molecular weight of 487.60 g/mol. Its IUPAC name is 2-[[2-(2-methyl-3-phenylphenyl)-6-(2-morpholin-4-ylethoxy)-1,3-benzoxazol-5-yl]methylamino]ethanol.
| Compound Name | 2-[[2-(2-methyl-3-phenylphenyl)-6-(2-morpholin-4-ylethoxy)-1,3-benzoxazol-5-yl]methylamino]ethanol |
|---|---|
| PubChem CID | 129137926 |
| Molecular Formula | C29H33N3O4 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | 2-[[2-(2-methyl-3-phenylphenyl)-6-(2-morpholin-4-ylethoxy)-1,3-benzoxazol-5-yl]methylamino]ethanol |
| SMILES | Cc1c(-c2ccccc2)cccc1-c1nc2cc(CNCCO)c(OCCN3CCOCC3)cc2o1 |
| InChI | InChI=1S/C29H33N3O4/c1-21-24(22-6-3-2-4-7-22)8-5-9-25(21)29-31-26-18-23(20-30-10-14-33)27(19-28(26)36-29)35-17-13-32-11-15-34-16-12-32/h2-9,18-19,30,33H,10-17,20H2,1H3 |
| InChIKey | VSLGIPZHVMRWRE-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 79.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|