C31H31N3O4 — CID 129137963
(2S)-1-[[6-(3-cyanopropoxy)-2-(2-methyl-3-phenylphenyl)-1,3-benzoxazol-5-yl]methyl]piperidine-2-carboxylic acid (PubChem CID 129137963) has the molecular formula C31H31N3O4 and a molecular weight of 509.61 g/mol. Its IUPAC name is (2S)-1-[[6-(3-cyanopropoxy)-2-(2-methyl-3-phenylphenyl)-1,3-benzoxazol-5-yl]methyl]piperidine-2-carboxylic acid.
| Compound Name | (2S)-1-[[6-(3-cyanopropoxy)-2-(2-methyl-3-phenylphenyl)-1,3-benzoxazol-5-yl]methyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 129137963 |
| Molecular Formula | C31H31N3O4 |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.23 |
| IUPAC Name | (2S)-1-[[6-(3-cyanopropoxy)-2-(2-methyl-3-phenylphenyl)-1,3-benzoxazol-5-yl]methyl]piperidine-2-carboxylic acid |
| SMILES | Cc1c(-c2ccccc2)cccc1-c1nc2cc(CN3CCCC[C@H]3C(=O)O)c(OCCCC#N)cc2o1 |
| InChI | InChI=1S/C31H31N3O4/c1-21-24(22-10-3-2-4-11-22)12-9-13-25(21)30-33-26-18-23(20-34-16-7-5-14-27(34)31(35)36)28(19-29(26)38-30)37-17-8-6-15-32/h2-4,9-13,18-19,27H,5-8,14,16-17,20H2,1H3,(H,35,36)/t27-/m0/s1 |
| InChIKey | DCSUWIPRZKZFBT-MHZLTWQESA-N |
| XLogP | 6.59 |
| TPSA | 99.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|