C35H33N3O4 — CID 102047064
methyl 4-[5-(dibutylamino)-9,12-dioxa-14,17-diazahexacyclo[14.7.0.02,10.03,8.011,15.018,23]tricosa-1,3(8),4,6,10,13,15,18,20,22-decaen-13-yl]benzoate (PubChem CID 102047064) has the molecular formula C35H33N3O4 and a molecular weight of 559.67 g/mol. Its IUPAC name is methyl 4-[5-(dibutylamino)-9,12-dioxa-14,17-diazahexacyclo[14.7.0.02,10.03,8.011,15.018,23]tricosa-1,3(8),4,6,10,13,15,18,20,22-decaen-13-yl]benzoate.
| Compound Name | methyl 4-[5-(dibutylamino)-9,12-dioxa-14,17-diazahexacyclo[14.7.0.02,10.03,8.011,15.018,23]tricosa-1,3(8),4,6,10,13,15,18,20,22-decaen-13-yl]benzoate |
|---|---|
| PubChem CID | 102047064 |
| Molecular Formula | C35H33N3O4 |
| Molecular Weight | 559.67 g/mol |
| Exact Mass | 559.25 |
| IUPAC Name | methyl 4-[5-(dibutylamino)-9,12-dioxa-14,17-diazahexacyclo[14.7.0.02,10.03,8.011,15.018,23]tricosa-1,3(8),4,6,10,13,15,18,20,22-decaen-13-yl]benzoate |
| SMILES | CCCCN(CCCC)c1ccc2oc3c4oc(-c5ccc(C(=O)OC)cc5)nc4c4[nH]c5ccccc5c4c3c2c1 |
| InChI | InChI=1S/C35H33N3O4/c1-4-6-18-38(19-7-5-2)23-16-17-27-25(20-23)29-28-24-10-8-9-11-26(24)36-30(28)31-33(32(29)41-27)42-34(37-31)21-12-14-22(15-13-21)35(39)40-3/h8-17,20,36H,4-7,18-19H2,1-3H3 |
| InChIKey | KXBPAIOVBMDSQV-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.67 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |