C31H35N3O4 — CID 20710254
3-[4-[1-[4-(dimethylamino)anilino]-3-oxo-2-benzofuran-1-yl]-N-ethylanilino]propyl 2-methylprop-2-enoate (PubChem CID 20710254) has the molecular formula C31H35N3O4 and a molecular weight of 513.64 g/mol. Its IUPAC name is 3-[4-[1-[4-(dimethylamino)anilino]-3-oxo-2-benzofuran-1-yl]-N-ethylanilino]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[4-[1-[4-(dimethylamino)anilino]-3-oxo-2-benzofuran-1-yl]-N-ethylanilino]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 20710254 |
| Molecular Formula | C31H35N3O4 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.26 |
| IUPAC Name | 3-[4-[1-[4-(dimethylamino)anilino]-3-oxo-2-benzofuran-1-yl]-N-ethylanilino]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCN(CC)c1ccc(C2(Nc3ccc(N(C)C)cc3)OC(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C31H35N3O4/c1-6-34(20-9-21-37-29(35)22(2)3)26-16-12-23(13-17-26)31(28-11-8-7-10-27(28)30(36)38-31)32-24-14-18-25(19-15-24)33(4)5/h7-8,10-19,32H,2,6,9,20-21H2,1,3-5H3 |
| InChIKey | AQYUHXPUHMFIAP-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|