C32H37N3O4 — CID 20710250
3-[[1,1-bis[4-(dimethylamino)phenyl]-3-oxo-2-benzofuran-5-yl]-methylamino]propyl 2-methylprop-2-enoate (PubChem CID 20710250) has the molecular formula C32H37N3O4 and a molecular weight of 527.67 g/mol. Its IUPAC name is 3-[[1,1-bis[4-(dimethylamino)phenyl]-3-oxo-2-benzofuran-5-yl]-methylamino]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[[1,1-bis[4-(dimethylamino)phenyl]-3-oxo-2-benzofuran-5-yl]-methylamino]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 20710250 |
| Molecular Formula | C32H37N3O4 |
| Molecular Weight | 527.67 g/mol |
| Exact Mass | 527.28 |
| IUPAC Name | 3-[[1,1-bis[4-(dimethylamino)phenyl]-3-oxo-2-benzofuran-5-yl]-methylamino]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCN(C)c1ccc2c(c1)C(=O)OC2(c1ccc(N(C)C)cc1)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C32H37N3O4/c1-22(2)30(36)38-20-8-19-35(7)27-17-18-29-28(21-27)31(37)39-32(29,23-9-13-25(14-10-23)33(3)4)24-11-15-26(16-12-24)34(5)6/h9-18,21H,1,8,19-20H2,2-7H3 |
| InChIKey | GOVFOWOEDLDGOJ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.67 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|