C28H33N3O2 — CID 139669536
5,5-bis[4-(diethylamino)phenyl]-4-methylfuro[3,4-b]pyridin-7-one (PubChem CID 139669536) has the molecular formula C28H33N3O2 and a molecular weight of 443.59 g/mol. Its IUPAC name is 5,5-bis[4-(diethylamino)phenyl]-4-methylfuro[3,4-b]pyridin-7-one.
| Compound Name | 5,5-bis[4-(diethylamino)phenyl]-4-methylfuro[3,4-b]pyridin-7-one |
|---|---|
| PubChem CID | 139669536 |
| Molecular Formula | C28H33N3O2 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.26 |
| IUPAC Name | 5,5-bis[4-(diethylamino)phenyl]-4-methylfuro[3,4-b]pyridin-7-one |
| SMILES | CCN(CC)c1ccc(C2(c3ccc(N(CC)CC)cc3)OC(=O)c3nccc(C)c32)cc1 |
| InChI | InChI=1S/C28H33N3O2/c1-6-30(7-2)23-14-10-21(11-15-23)28(22-12-16-24(17-13-22)31(8-3)9-4)25-20(5)18-19-29-26(25)27(32)33-28/h10-19H,6-9H2,1-5H3 |
| InChIKey | YWSLWHYKMJHICP-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|