C64H76N4O4 — CID 172813647
6-[2,3-bis(3-octoxyphenyl)quinoxalin-5-yl]-3,3-bis[4-(diethylamino)phenyl]-2-benzofuran-1-one (PubChem CID 172813647) has the molecular formula C64H76N4O4 and a molecular weight of 965.34 g/mol. Its IUPAC name is 6-[2,3-bis(3-octoxyphenyl)quinoxalin-5-yl]-3,3-bis[4-(diethylamino)phenyl]-2-benzofuran-1-one.
| Compound Name | 6-[2,3-bis(3-octoxyphenyl)quinoxalin-5-yl]-3,3-bis[4-(diethylamino)phenyl]-2-benzofuran-1-one |
|---|---|
| PubChem CID | 172813647 |
| Molecular Formula | C64H76N4O4 |
| Molecular Weight | 965.34 g/mol |
| Exact Mass | 964.59 |
| IUPAC Name | 6-[2,3-bis(3-octoxyphenyl)quinoxalin-5-yl]-3,3-bis[4-(diethylamino)phenyl]-2-benzofuran-1-one |
| SMILES | CCCCCCCCOc1cccc(-c2nc3cccc(-c4ccc5c(c4)C(=O)OC5(c4ccc(N(CC)CC)cc4)c4ccc(N(CC)CC)cc4)c3nc2-c2cccc(OCCCCCCCC)c2)c1 |
| InChI | InChI=1S/C64H76N4O4/c1-7-13-15-17-19-21-42-70-54-28-23-26-48(44-54)60-61(49-27-24-29-55(45-49)71-43-22-20-18-16-14-8-2)66-62-56(30-25-31-59(62)65-60)47-32-41-58-57(46-47)63(69)72-64(58,50-33-37-52(38-34-50)67(9-3)10-4)51-35-39-53(40-36-51)68(11-5)12-6/h23-41,44-46H,7-22,42-43H2,1-6H3 |
| InChIKey | SNFHOGMSSIIOBI-UHFFFAOYSA-N |
| XLogP | 16.26 |
| TPSA | 77.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 965.34 |
| LogP ≤ 5 | 16.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|