C39H50N2O4 — CID 139830449
4-[2,6-bis(2,4-dipropoxyphenyl)-4-pyridinyl]-N,N-diethylaniline (PubChem CID 139830449) has the molecular formula C39H50N2O4 and a molecular weight of 610.84 g/mol. Its IUPAC name is 4-[2,6-bis(2,4-dipropoxyphenyl)-4-pyridinyl]-N,N-diethylaniline.
| Compound Name | 4-[2,6-bis(2,4-dipropoxyphenyl)-4-pyridinyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 139830449 |
| Molecular Formula | C39H50N2O4 |
| Molecular Weight | 610.84 g/mol |
| Exact Mass | 610.38 |
| IUPAC Name | 4-[2,6-bis(2,4-dipropoxyphenyl)-4-pyridinyl]-N,N-diethylaniline |
| SMILES | CCCOc1ccc(-c2cc(-c3ccc(N(CC)CC)cc3)cc(-c3ccc(OCCC)cc3OCCC)n2)c(OCCC)c1 |
| InChI | InChI=1S/C39H50N2O4/c1-7-21-42-32-17-19-34(38(27-32)44-23-9-3)36-25-30(29-13-15-31(16-14-29)41(11-5)12-6)26-37(40-36)35-20-18-33(43-22-8-2)28-39(35)45-24-10-4/h13-20,25-28H,7-12,21-24H2,1-6H3 |
| InChIKey | FHGSUKPRIKYVGQ-UHFFFAOYSA-N |
| XLogP | 10.08 |
| TPSA | 53.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.84 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |