C46H54BrNO4 — CID 162394350
N-(4-bromophenyl)-4-(2,4-dibutoxyphenyl)-N-[4-(2,4-dibutoxyphenyl)phenyl]aniline (PubChem CID 162394350) has the molecular formula C46H54BrNO4 and a molecular weight of 764.84 g/mol. Its IUPAC name is N-(4-bromophenyl)-4-(2,4-dibutoxyphenyl)-N-[4-(2,4-dibutoxyphenyl)phenyl]aniline.
| Compound Name | N-(4-bromophenyl)-4-(2,4-dibutoxyphenyl)-N-[4-(2,4-dibutoxyphenyl)phenyl]aniline |
|---|---|
| PubChem CID | 162394350 |
| Molecular Formula | C46H54BrNO4 |
| Molecular Weight | 764.84 g/mol |
| Exact Mass | 763.32 |
| IUPAC Name | N-(4-bromophenyl)-4-(2,4-dibutoxyphenyl)-N-[4-(2,4-dibutoxyphenyl)phenyl]aniline |
| SMILES | CCCCOc1ccc(-c2ccc(N(c3ccc(Br)cc3)c3ccc(-c4ccc(OCCCC)cc4OCCCC)cc3)cc2)c(OCCCC)c1 |
| InChI | InChI=1S/C46H54BrNO4/c1-5-9-29-49-41-25-27-43(45(33-41)51-31-11-7-3)35-13-19-38(20-14-35)48(40-23-17-37(47)18-24-40)39-21-15-36(16-22-39)44-28-26-42(50-30-10-6-2)34-46(44)52-32-12-8-4/h13-28,33-34H,5-12,29-32H2,1-4H3 |
| InChIKey | QKMNKBZZYCIHHH-UHFFFAOYSA-N |
| XLogP | 13.97 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.84 |
| LogP ≤ 5 | 13.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|