C33H38N2O2 — CID 15375140
4-[2,6-bis(2-butoxyphenyl)-4-pyridinyl]-N,N-dimethylaniline (PubChem CID 15375140) has the molecular formula C33H38N2O2 and a molecular weight of 494.68 g/mol. Its IUPAC name is 4-[2,6-bis(2-butoxyphenyl)-4-pyridinyl]-N,N-dimethylaniline.
| Compound Name | 4-[2,6-bis(2-butoxyphenyl)-4-pyridinyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 15375140 |
| Molecular Formula | C33H38N2O2 |
| Molecular Weight | 494.68 g/mol |
| Exact Mass | 494.29 |
| IUPAC Name | 4-[2,6-bis(2-butoxyphenyl)-4-pyridinyl]-N,N-dimethylaniline |
| SMILES | CCCCOc1ccccc1-c1cc(-c2ccc(N(C)C)cc2)cc(-c2ccccc2OCCCC)n1 |
| InChI | InChI=1S/C33H38N2O2/c1-5-7-21-36-32-15-11-9-13-28(32)30-23-26(25-17-19-27(20-18-25)35(3)4)24-31(34-30)29-14-10-12-16-33(29)37-22-8-6-2/h9-20,23-24H,5-8,21-22H2,1-4H3 |
| InChIKey | ILYAEOXWJYZALF-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.68 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|