C33H39Cl4N3O2 — CID 54382194
3-[2,4-bis(diethylamino)phenyl]-4,5,6,7-tetrachloro-3-[4-(diethylamino)-2-methylphenyl]-2-benzofuran-1-one (PubChem CID 54382194) has the molecular formula C33H39Cl4N3O2 and a molecular weight of 651.51 g/mol. Its IUPAC name is 3-[2,4-bis(diethylamino)phenyl]-4,5,6,7-tetrachloro-3-[4-(diethylamino)-2-methylphenyl]-2-benzofuran-1-one.
| Compound Name | 3-[2,4-bis(diethylamino)phenyl]-4,5,6,7-tetrachloro-3-[4-(diethylamino)-2-methylphenyl]-2-benzofuran-1-one |
|---|---|
| PubChem CID | 54382194 |
| Molecular Formula | C33H39Cl4N3O2 |
| Molecular Weight | 651.51 g/mol |
| Exact Mass | 649.18 |
| IUPAC Name | 3-[2,4-bis(diethylamino)phenyl]-4,5,6,7-tetrachloro-3-[4-(diethylamino)-2-methylphenyl]-2-benzofuran-1-one |
| SMILES | CCN(CC)c1ccc(C2(c3ccc(N(CC)CC)cc3N(CC)CC)OC(=O)c3c(Cl)c(Cl)c(Cl)c(Cl)c32)c(C)c1 |
| InChI | InChI=1S/C33H39Cl4N3O2/c1-8-38(9-2)21-14-16-23(20(7)18-21)33(27-26(32(41)42-33)28(34)30(36)31(37)29(27)35)24-17-15-22(39(10-3)11-4)19-25(24)40(12-5)13-6/h14-19H,8-13H2,1-7H3 |
| InChIKey | VARZZQJRPJTJKN-UHFFFAOYSA-N |
| XLogP | 9.61 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.51 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|