C50H48Cl4N2O2 — CID 67877207
4,5,6,7-tetrachloro-3,3-bis[(E)-2-[4-(diethylamino)phenyl]-2-(4-prop-2-enylphenyl)ethenyl]-2-benzofuran-1-one (PubChem CID 67877207) has the molecular formula C50H48Cl4N2O2 and a molecular weight of 850.76 g/mol. Its IUPAC name is 4,5,6,7-tetrachloro-3,3-bis[(E)-2-[4-(diethylamino)phenyl]-2-(4-prop-2-enylphenyl)ethenyl]-2-benzofuran-1-one.
| Compound Name | 4,5,6,7-tetrachloro-3,3-bis[(E)-2-[4-(diethylamino)phenyl]-2-(4-prop-2-enylphenyl)ethenyl]-2-benzofuran-1-one |
|---|---|
| PubChem CID | 67877207 |
| Molecular Formula | C50H48Cl4N2O2 |
| Molecular Weight | 850.76 g/mol |
| Exact Mass | 848.25 |
| IUPAC Name | 4,5,6,7-tetrachloro-3,3-bis[(E)-2-[4-(diethylamino)phenyl]-2-(4-prop-2-enylphenyl)ethenyl]-2-benzofuran-1-one |
| SMILES | C=CCc1ccc(/C(=C\C2(/C=C(\c3ccc(CC=C)cc3)c3ccc(N(CC)CC)cc3)OC(=O)c3c(Cl)c(Cl)c(Cl)c(Cl)c32)c2ccc(N(CC)CC)cc2)cc1 |
| InChI | InChI=1S/C50H48Cl4N2O2/c1-7-13-33-15-19-35(20-16-33)41(37-23-27-39(28-24-37)55(9-3)10-4)31-50(44-43(49(57)58-50)45(51)47(53)48(54)46(44)52)32-42(36-21-17-34(14-8-2)18-22-36)38-25-29-40(30-26-38)56(11-5)12-6/h7-8,15-32H,1-2,9-14H2,3-6H3/b41-31+,42-32+ |
| InChIKey | RTZWWAYGIHZURS-LFOSYLFNSA-N |
| XLogP | 14.08 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.76 |
| LogP ≤ 5 | 14.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|