C32H26O2 — CID 67848404
1,2-bis[4-(4-prop-2-enylphenyl)phenyl]ethane-1,2-dione (PubChem CID 67848404) has the molecular formula C32H26O2 and a molecular weight of 442.56 g/mol. Its IUPAC name is 1,2-bis[4-(4-prop-2-enylphenyl)phenyl]ethane-1,2-dione.
| Compound Name | 1,2-bis[4-(4-prop-2-enylphenyl)phenyl]ethane-1,2-dione |
|---|---|
| PubChem CID | 67848404 |
| Molecular Formula | C32H26O2 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 1,2-bis[4-(4-prop-2-enylphenyl)phenyl]ethane-1,2-dione |
| SMILES | C=CCc1ccc(-c2ccc(C(=O)C(=O)c3ccc(-c4ccc(CC=C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C32H26O2/c1-3-5-23-7-11-25(12-8-23)27-15-19-29(20-16-27)31(33)32(34)30-21-17-28(18-22-30)26-13-9-24(6-4-2)10-14-26/h3-4,7-22H,1-2,5-6H2 |
| InChIKey | OBTCZAIBPBBQLF-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|