C20H22N4O2 — CID 138619870
1-N',2-N'-bis(4-prop-2-enylphenyl)ethanedihydrazide (PubChem CID 138619870) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is 1-N',2-N'-bis(4-prop-2-enylphenyl)ethanedihydrazide.
| Compound Name | 1-N',2-N'-bis(4-prop-2-enylphenyl)ethanedihydrazide |
|---|---|
| PubChem CID | 138619870 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 1-N',2-N'-bis(4-prop-2-enylphenyl)ethanedihydrazide |
| SMILES | C=CCc1ccc(NNC(=O)C(=O)NNc2ccc(CC=C)cc2)cc1 |
| InChI | InChI=1S/C20H22N4O2/c1-3-5-15-7-11-17(12-8-15)21-23-19(25)20(26)24-22-18-13-9-16(6-4-2)10-14-18/h3-4,7-14,21-22H,1-2,5-6H2,(H,23,25)(H,24,26) |
| InChIKey | DRLWRFXHBVHDPG-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|