C44H40Cl4N2O4 — CID 66658855
4,5,6,7-tetrachloro-3,3-bis[(Z)-2-[4-(dimethylamino)phenyl]-2-(4-methoxy-2-methylphenyl)ethenyl]-2-benzofuran-1-one (PubChem CID 66658855) has the molecular formula C44H40Cl4N2O4 and a molecular weight of 802.63 g/mol. Its IUPAC name is 4,5,6,7-tetrachloro-3,3-bis[(Z)-2-[4-(dimethylamino)phenyl]-2-(4-methoxy-2-methylphenyl)ethenyl]-2-benzofuran-1-one.
| Compound Name | 4,5,6,7-tetrachloro-3,3-bis[(Z)-2-[4-(dimethylamino)phenyl]-2-(4-methoxy-2-methylphenyl)ethenyl]-2-benzofuran-1-one |
|---|---|
| PubChem CID | 66658855 |
| Molecular Formula | C44H40Cl4N2O4 |
| Molecular Weight | 802.63 g/mol |
| Exact Mass | 800.17 |
| IUPAC Name | 4,5,6,7-tetrachloro-3,3-bis[(Z)-2-[4-(dimethylamino)phenyl]-2-(4-methoxy-2-methylphenyl)ethenyl]-2-benzofuran-1-one |
| SMILES | COc1ccc(/C(=C\C2(/C=C(/c3ccc(N(C)C)cc3)c3ccc(OC)cc3C)OC(=O)c3c(Cl)c(Cl)c(Cl)c(Cl)c32)c2ccc(N(C)C)cc2)c(C)c1 |
| InChI | InChI=1S/C44H40Cl4N2O4/c1-25-21-31(52-7)17-19-33(25)35(27-9-13-29(14-10-27)49(3)4)23-44(38-37(43(51)54-44)39(45)41(47)42(48)40(38)46)24-36(28-11-15-30(16-12-28)50(5)6)34-20-18-32(53-8)22-26(34)2/h9-24H,1-8H3/b35-23-,36-24- |
| InChIKey | SOKXJWKTPNXTEF-RXCNPGAZSA-N |
| XLogP | 11.70 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.63 |
| LogP ≤ 5 | 11.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|