C38H28Cl4N2O4 — CID 67935382
3,3-bis[(Z)-2-(4-aminophenyl)-2-(4-methoxyphenyl)ethenyl]-4,5,6,7-tetrachloro-2-benzofuran-1-one (PubChem CID 67935382) has the molecular formula C38H28Cl4N2O4 and a molecular weight of 718.46 g/mol. Its IUPAC name is 3,3-bis[(Z)-2-(4-aminophenyl)-2-(4-methoxyphenyl)ethenyl]-4,5,6,7-tetrachloro-2-benzofuran-1-one.
| Compound Name | 3,3-bis[(Z)-2-(4-aminophenyl)-2-(4-methoxyphenyl)ethenyl]-4,5,6,7-tetrachloro-2-benzofuran-1-one |
|---|---|
| PubChem CID | 67935382 |
| Molecular Formula | C38H28Cl4N2O4 |
| Molecular Weight | 718.46 g/mol |
| Exact Mass | 716.08 |
| IUPAC Name | 3,3-bis[(Z)-2-(4-aminophenyl)-2-(4-methoxyphenyl)ethenyl]-4,5,6,7-tetrachloro-2-benzofuran-1-one |
| SMILES | COc1ccc(/C(=C\C2(/C=C(/c3ccc(N)cc3)c3ccc(OC)cc3)OC(=O)c3c(Cl)c(Cl)c(Cl)c(Cl)c32)c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C38H28Cl4N2O4/c1-46-27-15-7-23(8-16-27)29(21-3-11-25(43)12-4-21)19-38(32-31(37(45)48-38)33(39)35(41)36(42)34(32)40)20-30(22-5-13-26(44)14-6-22)24-9-17-28(47-2)18-10-24/h3-20H,43-44H2,1-2H3/b29-19-,30-20- |
| InChIKey | XHGGYAVGBZPPNH-NAZWXXJZSA-N |
| XLogP | 10.11 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.46 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|