C56H60Cl4N2O4 — CID 54480691
4,5,6,7-tetrachloro-3,3-bis[2-[2-(cyclohexylmethylamino)-4-methylphenyl]-2-(4-methoxy-3-methylphenyl)ethenyl]-2-benzofuran-1-one (PubChem CID 54480691) has the molecular formula C56H60Cl4N2O4 and a molecular weight of 966.92 g/mol. Its IUPAC name is 4,5,6,7-tetrachloro-3,3-bis[2-[2-(cyclohexylmethylamino)-4-methylphenyl]-2-(4-methoxy-3-methylphenyl)ethenyl]-2-benzofuran-1-one.
| Compound Name | 4,5,6,7-tetrachloro-3,3-bis[2-[2-(cyclohexylmethylamino)-4-methylphenyl]-2-(4-methoxy-3-methylphenyl)ethenyl]-2-benzofuran-1-one |
|---|---|
| PubChem CID | 54480691 |
| Molecular Formula | C56H60Cl4N2O4 |
| Molecular Weight | 966.92 g/mol |
| Exact Mass | 964.33 |
| IUPAC Name | 4,5,6,7-tetrachloro-3,3-bis[2-[2-(cyclohexylmethylamino)-4-methylphenyl]-2-(4-methoxy-3-methylphenyl)ethenyl]-2-benzofuran-1-one |
| SMILES | COc1ccc(C(=CC2(C=C(c3ccc(OC)c(C)c3)c3ccc(C)cc3NCC3CCCCC3)OC(=O)c3c(Cl)c(Cl)c(Cl)c(Cl)c32)c2ccc(C)cc2NCC2CCCCC2)cc1C |
| InChI | InChI=1S/C56H60Cl4N2O4/c1-33-17-21-41(45(25-33)61-31-37-13-9-7-10-14-37)43(39-19-23-47(64-5)35(3)27-39)29-56(50-49(55(63)66-56)51(57)53(59)54(60)52(50)58)30-44(40-20-24-48(65-6)36(4)28-40)42-22-18-34(2)26-46(42)62-32-38-15-11-8-12-16-38/h17-30,37-38,61-62H,7-16,31-32H2,1-6H3 |
| InChIKey | XOUJNRYXXKCNIV-UHFFFAOYSA-N |
| XLogP | 16.16 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 966.92 |
| LogP ≤ 5 | 16.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|