C31H41N5O2 — CID 139642806
3,3-bis[4-(diethylamino)-2-(dimethylamino)phenyl]furo[3,4-c]pyridin-1-one (PubChem CID 139642806) has the molecular formula C31H41N5O2 and a molecular weight of 515.70 g/mol. Its IUPAC name is 3,3-bis[4-(diethylamino)-2-(dimethylamino)phenyl]furo[3,4-c]pyridin-1-one.
| Compound Name | 3,3-bis[4-(diethylamino)-2-(dimethylamino)phenyl]furo[3,4-c]pyridin-1-one |
|---|---|
| PubChem CID | 139642806 |
| Molecular Formula | C31H41N5O2 |
| Molecular Weight | 515.70 g/mol |
| Exact Mass | 515.33 |
| IUPAC Name | 3,3-bis[4-(diethylamino)-2-(dimethylamino)phenyl]furo[3,4-c]pyridin-1-one |
| SMILES | CCN(CC)c1ccc(C2(c3ccc(N(CC)CC)cc3N(C)C)OC(=O)c3ccncc32)c(N(C)C)c1 |
| InChI | InChI=1S/C31H41N5O2/c1-9-35(10-2)22-13-15-25(28(19-22)33(5)6)31(27-21-32-18-17-24(27)30(37)38-31)26-16-14-23(36(11-3)12-4)20-29(26)34(7)8/h13-21H,9-12H2,1-8H3 |
| InChIKey | DFVMMKQSHJADET-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 52.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.70 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|