C46H61N3O2 — CID 20534311
3-[4-(diethylamino)-2-methylphenyl]-3-(4-octyl-N-(4-octylphenyl)anilino)furo[3,4-c]pyridin-1-one (PubChem CID 20534311) has the molecular formula C46H61N3O2 and a molecular weight of 688.01 g/mol. Its IUPAC name is 3-[4-(diethylamino)-2-methylphenyl]-3-(4-octyl-N-(4-octylphenyl)anilino)furo[3,4-c]pyridin-1-one.
| Compound Name | 3-[4-(diethylamino)-2-methylphenyl]-3-(4-octyl-N-(4-octylphenyl)anilino)furo[3,4-c]pyridin-1-one |
|---|---|
| PubChem CID | 20534311 |
| Molecular Formula | C46H61N3O2 |
| Molecular Weight | 688.01 g/mol |
| Exact Mass | 687.48 |
| IUPAC Name | 3-[4-(diethylamino)-2-methylphenyl]-3-(4-octyl-N-(4-octylphenyl)anilino)furo[3,4-c]pyridin-1-one |
| SMILES | CCCCCCCCc1ccc(N(c2ccc(CCCCCCCC)cc2)C2(c3ccc(N(CC)CC)cc3C)OC(=O)c3ccncc32)cc1 |
| InChI | InChI=1S/C46H61N3O2/c1-6-10-12-14-16-18-20-37-22-26-39(27-23-37)49(40-28-24-38(25-29-40)21-19-17-15-13-11-7-2)46(44-35-47-33-32-42(44)45(50)51-46)43-31-30-41(34-36(43)5)48(8-3)9-4/h22-35H,6-21H2,1-5H3 |
| InChIKey | DWCUBJMLIDHAAO-UHFFFAOYSA-N |
| XLogP | 12.25 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.01 |
| LogP ≤ 5 | 12.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|