C28H26N4O2 — CID 20534319
5-[4-(diethylamino)phenyl]-5-(N-phenylanilino)furo[3,4-b]pyrazin-7-one (PubChem CID 20534319) has the molecular formula C28H26N4O2 and a molecular weight of 450.54 g/mol. Its IUPAC name is 5-[4-(diethylamino)phenyl]-5-(N-phenylanilino)furo[3,4-b]pyrazin-7-one.
| Compound Name | 5-[4-(diethylamino)phenyl]-5-(N-phenylanilino)furo[3,4-b]pyrazin-7-one |
|---|---|
| PubChem CID | 20534319 |
| Molecular Formula | C28H26N4O2 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | 5-[4-(diethylamino)phenyl]-5-(N-phenylanilino)furo[3,4-b]pyrazin-7-one |
| SMILES | CCN(CC)c1ccc(C2(N(c3ccccc3)c3ccccc3)OC(=O)c3nccnc32)cc1 |
| InChI | InChI=1S/C28H26N4O2/c1-3-31(4-2)22-17-15-21(16-18-22)28(26-25(27(33)34-28)29-19-20-30-26)32(23-11-7-5-8-12-23)24-13-9-6-10-14-24/h5-20H,3-4H2,1-2H3 |
| InChIKey | LLGVGQSTGCHJLF-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |