C30H29N3O2 — CID 139669553
5-(1-ethylindol-3-yl)-5-(1-pentylindol-3-yl)furo[3,4-b]pyridin-7-one (PubChem CID 139669553) has the molecular formula C30H29N3O2 and a molecular weight of 463.58 g/mol. Its IUPAC name is 5-(1-ethylindol-3-yl)-5-(1-pentylindol-3-yl)furo[3,4-b]pyridin-7-one.
| Compound Name | 5-(1-ethylindol-3-yl)-5-(1-pentylindol-3-yl)furo[3,4-b]pyridin-7-one |
|---|---|
| PubChem CID | 139669553 |
| Molecular Formula | C30H29N3O2 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | 5-(1-ethylindol-3-yl)-5-(1-pentylindol-3-yl)furo[3,4-b]pyridin-7-one |
| SMILES | CCCCCn1cc(C2(c3cn(CC)c4ccccc34)OC(=O)c3ncccc32)c2ccccc21 |
| InChI | InChI=1S/C30H29N3O2/c1-3-5-10-18-33-20-25(22-13-7-9-16-27(22)33)30(23-14-11-17-31-28(23)29(34)35-30)24-19-32(4-2)26-15-8-6-12-21(24)26/h6-9,11-17,19-20H,3-5,10,18H2,1-2H3 |
| InChIKey | BGQDBXNFHUKCIP-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 49.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|