C31H45F3N3O10P — CID 88570517
[3-(5-hydroxypentylcarbamoyl)-6-[4-(methylamino)butoxy-[4-[(2,2,2-trifluoroacetyl)amino]butoxy]phosphoryl]-2-oxochromen-7-yl] 2,2-dimethylpropanoate (PubChem CID 88570517) has the molecular formula C31H45F3N3O10P and a molecular weight of 707.68 g/mol. Its IUPAC name is [3-(5-hydroxypentylcarbamoyl)-6-[4-(methylamino)butoxy-[4-[(2,2,2-trifluoroacetyl)amino]butoxy]phosphoryl]-2-oxochromen-7-yl] 2,2-dimethylpropanoate.
| Compound Name | [3-(5-hydroxypentylcarbamoyl)-6-[4-(methylamino)butoxy-[4-[(2,2,2-trifluoroacetyl)amino]butoxy]phosphoryl]-2-oxochromen-7-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 88570517 |
| Molecular Formula | C31H45F3N3O10P |
| Molecular Weight | 707.68 g/mol |
| Exact Mass | 707.28 |
| IUPAC Name | [3-(5-hydroxypentylcarbamoyl)-6-[4-(methylamino)butoxy-[4-[(2,2,2-trifluoroacetyl)amino]butoxy]phosphoryl]-2-oxochromen-7-yl] 2,2-dimethylpropanoate |
| SMILES | CNCCCCOP(=O)(OCCCCNC(=O)C(F)(F)F)c1cc2cc(C(=O)NCCCCCO)c(=O)oc2cc1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C31H45F3N3O10P/c1-30(2,3)29(42)47-24-20-23-21(18-22(27(40)46-23)26(39)36-13-6-5-9-15-38)19-25(24)48(43,44-16-10-7-12-35-4)45-17-11-8-14-37-28(41)31(32,33)34/h18-20,35,38H,5-17H2,1-4H3,(H,36,39)(H,37,41) |
| InChIKey | LXWLPMRZGYTTRN-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 182.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.68 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|