C30H38IN2O4P — CID 131745688
2-[2-[[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetyl]amino]ethoxy]ethyl-triphenylphosphanium iodide (PubChem CID 131745688) has the molecular formula C30H38IN2O4P and a molecular weight of 648.52 g/mol. Its IUPAC name is 2-[2-[[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetyl]amino]ethoxy]ethyl-triphenylphosphanium iodide.
| Compound Name | 2-[2-[[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetyl]amino]ethoxy]ethyl-triphenylphosphanium iodide |
|---|---|
| PubChem CID | 131745688 |
| Molecular Formula | C30H38IN2O4P |
| Molecular Weight | 648.52 g/mol |
| Exact Mass | 648.16 |
| IUPAC Name | 2-[2-[[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetyl]amino]ethoxy]ethyl-triphenylphosphanium iodide |
| SMILES | CN(CC(=O)NCCOCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)OC(C)(C)C.[I-] |
| InChI | InChI=1S/C30H37N2O4P.HI/c1-30(2,3)36-29(34)32(4)24-28(33)31-20-21-35-22-23-37(25-14-8-5-9-15-25,26-16-10-6-11-17-26)27-18-12-7-13-19-27;/h5-19H,20-24H2,1-4H3;1H |
| InChIKey | BXDWHMYWAPWEIQ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.52 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|