C34H44BrN2O4P — CID 89463008
3-[[4-[[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]oxane-4-carbonyl]amino]propyl-triphenylphosphanium bromide (PubChem CID 89463008) has the molecular formula C34H44BrN2O4P and a molecular weight of 655.61 g/mol. Its IUPAC name is 3-[[4-[[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]oxane-4-carbonyl]amino]propyl-triphenylphosphanium bromide.
| Compound Name | 3-[[4-[[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]oxane-4-carbonyl]amino]propyl-triphenylphosphanium bromide |
|---|---|
| PubChem CID | 89463008 |
| Molecular Formula | C34H44BrN2O4P |
| Molecular Weight | 655.61 g/mol |
| Exact Mass | 654.22 |
| IUPAC Name | 3-[[4-[[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]oxane-4-carbonyl]amino]propyl-triphenylphosphanium bromide |
| SMILES | CN(CC1(C(=O)NCCC[P+](c2ccccc2)(c2ccccc2)c2ccccc2)CCOCC1)C(=O)OC(C)(C)C.[Br-] |
| InChI | InChI=1S/C34H43N2O4P.BrH/c1-33(2,3)40-32(38)36(4)27-34(21-24-39-25-22-34)31(37)35-23-14-26-41(28-15-8-5-9-16-28,29-17-10-6-11-18-29)30-19-12-7-13-20-30;/h5-13,15-20H,14,21-27H2,1-4H3;1H |
| InChIKey | HPGKSLJIQAXSKB-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.61 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|