C32H41ClN3O4P — CID 131745686
[4-[2-[[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetyl]amino]ethylamino]-4-oxobutyl]-triphenylphosphanium chloride (PubChem CID 131745686) has the molecular formula C32H41ClN3O4P and a molecular weight of 598.12 g/mol. Its IUPAC name is [4-[2-[[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetyl]amino]ethylamino]-4-oxobutyl]-triphenylphosphanium chloride.
| Compound Name | [4-[2-[[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetyl]amino]ethylamino]-4-oxobutyl]-triphenylphosphanium chloride |
|---|---|
| PubChem CID | 131745686 |
| Molecular Formula | C32H41ClN3O4P |
| Molecular Weight | 598.12 g/mol |
| Exact Mass | 597.25 |
| IUPAC Name | [4-[2-[[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetyl]amino]ethylamino]-4-oxobutyl]-triphenylphosphanium chloride |
| SMILES | CN(CC(=O)NCCNC(=O)CCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)OC(C)(C)C.[Cl-] |
| InChI | InChI=1S/C32H40N3O4P.ClH/c1-32(2,3)39-31(38)35(4)25-30(37)34-23-22-33-29(36)21-14-24-40(26-15-8-5-9-16-26,27-17-10-6-11-18-27)28-19-12-7-13-20-28;/h5-13,15-20H,14,21-25H2,1-4H3,(H-,33,34,36,37);1H |
| InChIKey | IDRNGTFFVXTKLP-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.12 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|