C14H22BN2O6 — CID 158955004
CID 158955004 (PubChem CID 158955004) has the molecular formula C14H22BN2O6 and a molecular weight of 325.15 g/mol.
| Compound Name | CID 158955004 |
|---|---|
| PubChem CID | 158955004 |
| Molecular Formula | C14H22BN2O6 |
| Molecular Weight | 325.15 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | — |
| SMILES | CC(C)(C)OC(=O)NCCOCCOc1cc(O[B]O)ccn1 |
| InChI | InChI=1S/C14H22BN2O6/c1-14(2,3)22-13(18)17-6-7-20-8-9-21-12-10-11(23-15-19)4-5-16-12/h4-5,10,19H,6-9H2,1-3H3,(H,17,18) |
| InChIKey | BUTOSBMPDIDDHZ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 99.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.15 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|