C21H28N2O7 — CID 175982513
6-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]quinoline-4-carboxylic acid (PubChem CID 175982513) has the molecular formula C21H28N2O7 and a molecular weight of 420.46 g/mol. Its IUPAC name is 6-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]quinoline-4-carboxylic acid.
| Compound Name | 6-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 175982513 |
| Molecular Formula | C21H28N2O7 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | 6-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]quinoline-4-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCOc1ccc2nccc(C(=O)O)c2c1 |
| InChI | InChI=1S/C21H28N2O7/c1-21(2,3)30-20(26)23-8-9-27-10-11-28-12-13-29-15-4-5-18-17(14-15)16(19(24)25)6-7-22-18/h4-7,14H,8-13H2,1-3H3,(H,23,26)(H,24,25) |
| InChIKey | WGFBKABPOJOPET-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 116.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|