C12H17N5OS — CID 71849693
N-[2-(5-methyltetrazol-2-yl)ethyl]-3-propan-2-ylthiophene-2-carboxamide (PubChem CID 71849693) has the molecular formula C12H17N5OS and a molecular weight of 279.37 g/mol. Its IUPAC name is N-[2-(5-methyltetrazol-2-yl)ethyl]-3-propan-2-ylthiophene-2-carboxamide.
| Compound Name | N-[2-(5-methyltetrazol-2-yl)ethyl]-3-propan-2-ylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 71849693 |
| Molecular Formula | C12H17N5OS |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | N-[2-(5-methyltetrazol-2-yl)ethyl]-3-propan-2-ylthiophene-2-carboxamide |
| SMILES | Cc1nnn(CCNC(=O)c2sccc2C(C)C)n1 |
| InChI | InChI=1S/C12H17N5OS/c1-8(2)10-4-7-19-11(10)12(18)13-5-6-17-15-9(3)14-16-17/h4,7-8H,5-6H2,1-3H3,(H,13,18) |
| InChIKey | PEPXFWOJCLCRAD-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |