C11H17BrN4O4 — CID 147324568
methyl 5-bromo-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]triazole-4-carboxylate (PubChem CID 147324568) has the molecular formula C11H17BrN4O4 and a molecular weight of 349.19 g/mol. Its IUPAC name is methyl 5-bromo-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]triazole-4-carboxylate.
| Compound Name | methyl 5-bromo-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 147324568 |
| Molecular Formula | C11H17BrN4O4 |
| Molecular Weight | 349.19 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | methyl 5-bromo-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]triazole-4-carboxylate |
| SMILES | COC(=O)c1nnn(CCNC(=O)OC(C)(C)C)c1Br |
| InChI | InChI=1S/C11H17BrN4O4/c1-11(2,3)20-10(18)13-5-6-16-8(12)7(14-15-16)9(17)19-4/h5-6H2,1-4H3,(H,13,18) |
| InChIKey | DALQIPOFUYNSGK-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.19 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |