C13H19N5O2 — CID 19854428
tert-butyl N-[2-(imidazo[1,2-b]pyridazin-6-ylamino)ethyl]carbamate (PubChem CID 19854428) has the molecular formula C13H19N5O2 and a molecular weight of 277.33 g/mol. Its IUPAC name is tert-butyl N-[2-(imidazo[1,2-b]pyridazin-6-ylamino)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(imidazo[1,2-b]pyridazin-6-ylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 19854428 |
| Molecular Formula | C13H19N5O2 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | tert-butyl N-[2-(imidazo[1,2-b]pyridazin-6-ylamino)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNc1ccc2nccn2n1 |
| InChI | InChI=1S/C13H19N5O2/c1-13(2,3)20-12(19)16-7-6-14-10-4-5-11-15-8-9-18(11)17-10/h4-5,8-9H,6-7H2,1-3H3,(H,14,17)(H,16,19) |
| InChIKey | XFORSXFOVNLZTN-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 80.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|