C21H19ClN6O — CID 132992834
(2R)-N-(8-chloro-2,3,4,9-tetrahydro-1H-carbazol-1-yl)-2-phenyl-2-(tetrazol-1-yl)acetamide (PubChem CID 132992834) has the molecular formula C21H19ClN6O and a molecular weight of 406.88 g/mol. Its IUPAC name is (2R)-N-(8-chloro-2,3,4,9-tetrahydro-1H-carbazol-1-yl)-2-phenyl-2-(tetrazol-1-yl)acetamide.
| Compound Name | (2R)-N-(8-chloro-2,3,4,9-tetrahydro-1H-carbazol-1-yl)-2-phenyl-2-(tetrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 132992834 |
| Molecular Formula | C21H19ClN6O |
| Molecular Weight | 406.88 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | (2R)-N-(8-chloro-2,3,4,9-tetrahydro-1H-carbazol-1-yl)-2-phenyl-2-(tetrazol-1-yl)acetamide |
| SMILES | O=C(NC1CCCc2c1[nH]c1c(Cl)cccc21)[C@@H](c1ccccc1)n1cnnn1 |
| InChI | InChI=1S/C21H19ClN6O/c22-16-10-4-8-14-15-9-5-11-17(19(15)25-18(14)16)24-21(29)20(28-12-23-26-27-28)13-6-2-1-3-7-13/h1-4,6-8,10,12,17,20,25H,5,9,11H2,(H,24,29)/t17?,20-/m1/s1 |
| InChIKey | IFDFGGDCNCKFPR-UUSAFJCLSA-N |
| XLogP | 3.59 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.88 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|