C22H26ClN3O — CID 125124025
(2R)-N-[(1R)-8-chloro-2,3,4,9-tetrahydro-1H-carbazol-1-yl]-4-methyl-2-pyrrol-1-ylpentanamide (PubChem CID 125124025) has the molecular formula C22H26ClN3O and a molecular weight of 383.92 g/mol. Its IUPAC name is (2R)-N-[(1R)-8-chloro-2,3,4,9-tetrahydro-1H-carbazol-1-yl]-4-methyl-2-pyrrol-1-ylpentanamide.
| Compound Name | (2R)-N-[(1R)-8-chloro-2,3,4,9-tetrahydro-1H-carbazol-1-yl]-4-methyl-2-pyrrol-1-ylpentanamide |
|---|---|
| PubChem CID | 125124025 |
| Molecular Formula | C22H26ClN3O |
| Molecular Weight | 383.92 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | (2R)-N-[(1R)-8-chloro-2,3,4,9-tetrahydro-1H-carbazol-1-yl]-4-methyl-2-pyrrol-1-ylpentanamide |
| SMILES | CC(C)C[C@H](C(=O)N[C@@H]1CCCc2c1[nH]c1c(Cl)cccc21)n1cccc1 |
| InChI | InChI=1S/C22H26ClN3O/c1-14(2)13-19(26-11-3-4-12-26)22(27)24-18-10-6-8-16-15-7-5-9-17(23)20(15)25-21(16)18/h3-5,7,9,11-12,14,18-19,25H,6,8,10,13H2,1-2H3,(H,24,27)/t18-,19-/m1/s1 |
| InChIKey | SIQIOAZDCGEASD-RTBURBONSA-N |
| XLogP | 5.40 |
| TPSA | 49.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.92 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|