C22H25NO3 — CID 91597352
[(3R)-1-azabicyclo[2.2.2]octan-3-yl] 2-(2-hydroxyphenyl)-2-(2-methylphenyl)acetate (PubChem CID 91597352) has the molecular formula C22H25NO3 and a molecular weight of 351.45 g/mol. Its IUPAC name is [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 2-(2-hydroxyphenyl)-2-(2-methylphenyl)acetate.
| Compound Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 2-(2-hydroxyphenyl)-2-(2-methylphenyl)acetate |
|---|---|
| PubChem CID | 91597352 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 2-(2-hydroxyphenyl)-2-(2-methylphenyl)acetate |
| SMILES | Cc1ccccc1C(C(=O)O[C@H]1CN2CCC1CC2)c1ccccc1O |
| InChI | InChI=1S/C22H25NO3/c1-15-6-2-3-7-17(15)21(18-8-4-5-9-19(18)24)22(25)26-20-14-23-12-10-16(20)11-13-23/h2-9,16,20-21,24H,10-14H2,1H3/t20-,21?/m0/s1 |
| InChIKey | PGWRPYIVQROCDI-BGERDNNASA-N |
| XLogP | 3.47 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |