C27H28ClNO4S — CID 44816486
benzhydryl [(3R)-1-(2-oxo-2-thiophen-2-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] carbonate chloride (PubChem CID 44816486) has the molecular formula C27H28ClNO4S and a molecular weight of 498.04 g/mol. Its IUPAC name is benzhydryl [(3R)-1-(2-oxo-2-thiophen-2-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] carbonate chloride.
| Compound Name | benzhydryl [(3R)-1-(2-oxo-2-thiophen-2-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] carbonate chloride |
|---|---|
| PubChem CID | 44816486 |
| Molecular Formula | C27H28ClNO4S |
| Molecular Weight | 498.04 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | benzhydryl [(3R)-1-(2-oxo-2-thiophen-2-ylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] carbonate chloride |
| SMILES | O=C(OC(c1ccccc1)c1ccccc1)O[C@H]1C[N+]2(CC(=O)c3cccs3)CCC1CC2.[Cl-] |
| InChI | InChI=1S/C27H28NO4S.ClH/c29-23(25-12-7-17-33-25)18-28-15-13-20(14-16-28)24(19-28)31-27(30)32-26(21-8-3-1-4-9-21)22-10-5-2-6-11-22;/h1-12,17,20,24,26H,13-16,18-19H2;1H/q+1;/p-1/t20?,24-,28?;/m0./s1 |
| InChIKey | CYZUJRRHZQMYQO-ZCPSHXKASA-M |
| XLogP | 2.49 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.04 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|