C29H27BrF3NO3 — CID 70673754
bis(3-fluorophenyl)methyl 1-[2-(2-fluorophenyl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octane-3-carboxylate bromide (PubChem CID 70673754) has the molecular formula C29H27BrF3NO3 and a molecular weight of 574.44 g/mol. Its IUPAC name is bis(3-fluorophenyl)methyl 1-[2-(2-fluorophenyl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octane-3-carboxylate bromide.
| Compound Name | bis(3-fluorophenyl)methyl 1-[2-(2-fluorophenyl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octane-3-carboxylate bromide |
|---|---|
| PubChem CID | 70673754 |
| Molecular Formula | C29H27BrF3NO3 |
| Molecular Weight | 574.44 g/mol |
| Exact Mass | 573.11 |
| IUPAC Name | bis(3-fluorophenyl)methyl 1-[2-(2-fluorophenyl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octane-3-carboxylate bromide |
| SMILES | O=C(C[N+]12CCC(CC1)C(C(=O)OC(c1cccc(F)c1)c1cccc(F)c1)C2)c1ccccc1F.[Br-] |
| InChI | InChI=1S/C29H27F3NO3.BrH/c30-22-7-3-5-20(15-22)28(21-6-4-8-23(31)16-21)36-29(35)25-17-33(13-11-19(25)12-14-33)18-27(34)24-9-1-2-10-26(24)32;/h1-10,15-16,19,25,28H,11-14,17-18H2;1H/q+1;/p-1 |
| InChIKey | HPISMWWFPRVNLL-UHFFFAOYSA-M |
| XLogP | 2.48 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.44 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|