C29H30F3N2O3+ — CID 69274735
[(3R)-1-(2-phenoxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-[(3,4-difluorophenyl)methyl]-N-(3-fluorophenyl)carbamate (PubChem CID 69274735) has the molecular formula C29H30F3N2O3+ and a molecular weight of 511.56 g/mol. Its IUPAC name is [(3R)-1-(2-phenoxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-[(3,4-difluorophenyl)methyl]-N-(3-fluorophenyl)carbamate.
| Compound Name | [(3R)-1-(2-phenoxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-[(3,4-difluorophenyl)methyl]-N-(3-fluorophenyl)carbamate |
|---|---|
| PubChem CID | 69274735 |
| Molecular Formula | C29H30F3N2O3+ |
| Molecular Weight | 511.56 g/mol |
| Exact Mass | 511.22 |
| IUPAC Name | [(3R)-1-(2-phenoxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-[(3,4-difluorophenyl)methyl]-N-(3-fluorophenyl)carbamate |
| SMILES | O=C(O[C@H]1C[N+]2(CCOc3ccccc3)CCC1CC2)N(Cc1ccc(F)c(F)c1)c1cccc(F)c1 |
| InChI | InChI=1S/C29H30F3N2O3/c30-23-5-4-6-24(18-23)33(19-21-9-10-26(31)27(32)17-21)29(35)37-28-20-34(13-11-22(28)12-14-34)15-16-36-25-7-2-1-3-8-25/h1-10,17-18,22,28H,11-16,19-20H2/q+1/t22?,28-,34?/m0/s1 |
| InChIKey | DISXBHIGKZNHKI-XRFIPTKVSA-N |
| XLogP | 5.94 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.56 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|