C30H34BrFN2O3 — CID 160870458
[(3R)-1-[2-(3-methoxyphenyl)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] N-[(4-fluorophenyl)methyl]-N-phenylcarbamate bromide (PubChem CID 160870458) has the molecular formula C30H34BrFN2O3 and a molecular weight of 569.52 g/mol. Its IUPAC name is [(3R)-1-[2-(3-methoxyphenyl)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] N-[(4-fluorophenyl)methyl]-N-phenylcarbamate bromide.
| Compound Name | [(3R)-1-[2-(3-methoxyphenyl)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] N-[(4-fluorophenyl)methyl]-N-phenylcarbamate bromide |
|---|---|
| PubChem CID | 160870458 |
| Molecular Formula | C30H34BrFN2O3 |
| Molecular Weight | 569.52 g/mol |
| Exact Mass | 568.17 |
| IUPAC Name | [(3R)-1-[2-(3-methoxyphenyl)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] N-[(4-fluorophenyl)methyl]-N-phenylcarbamate bromide |
| SMILES | COc1cccc(CC[N+]23CCC(CC2)[C@@H](OC(=O)N(Cc2ccc(F)cc2)c2ccccc2)C3)c1.[Br-] |
| InChI | InChI=1S/C30H34FN2O3.BrH/c1-35-28-9-5-6-23(20-28)14-17-33-18-15-25(16-19-33)29(22-33)36-30(34)32(27-7-3-2-4-8-27)21-24-10-12-26(31)13-11-24;/h2-13,20,25,29H,14-19,21-22H2,1H3;1H/q+1;/p-1/t25?,29-,33?;/m0./s1 |
| InChIKey | SLRLNWXXQDCHLR-SUVRUAAESA-M |
| XLogP | 2.83 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.52 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|