C23H29N2O3+ — CID 18456722
[(3R)-1-(2-hydroxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-benzyl-N-phenylcarbamate (PubChem CID 18456722) has the molecular formula C23H29N2O3+ and a molecular weight of 381.50 g/mol. Its IUPAC name is [(3R)-1-(2-hydroxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-benzyl-N-phenylcarbamate.
| Compound Name | [(3R)-1-(2-hydroxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-benzyl-N-phenylcarbamate |
|---|---|
| PubChem CID | 18456722 |
| Molecular Formula | C23H29N2O3+ |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | [(3R)-1-(2-hydroxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-benzyl-N-phenylcarbamate |
| SMILES | O=C(O[C@H]1C[N+]2(CCO)CCC1CC2)N(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H29N2O3/c26-16-15-25-13-11-20(12-14-25)22(18-25)28-23(27)24(21-9-5-2-6-10-21)17-19-7-3-1-4-8-19/h1-10,20,22,26H,11-18H2/q+1/t20?,22-,25?/m0/s1 |
| InChIKey | YXCOXOZASNTUTR-CVCZCXRASA-N |
| XLogP | 3.43 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|