C28H32BrN2O3S+ — CID 69277352
[(3R)-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-[(5-bromothiophen-2-yl)methyl]-N-phenylcarbamate (PubChem CID 69277352) has the molecular formula C28H32BrN2O3S+ and a molecular weight of 556.55 g/mol. Its IUPAC name is [(3R)-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-[(5-bromothiophen-2-yl)methyl]-N-phenylcarbamate.
| Compound Name | [(3R)-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-[(5-bromothiophen-2-yl)methyl]-N-phenylcarbamate |
|---|---|
| PubChem CID | 69277352 |
| Molecular Formula | C28H32BrN2O3S+ |
| Molecular Weight | 556.55 g/mol |
| Exact Mass | 555.13 |
| IUPAC Name | [(3R)-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-[(5-bromothiophen-2-yl)methyl]-N-phenylcarbamate |
| SMILES | O=C(O[C@H]1C[N+]2(CCCOc3ccccc3)CCC1CC2)N(Cc1ccc(Br)s1)c1ccccc1 |
| InChI | InChI=1S/C28H32BrN2O3S/c29-27-13-12-25(35-27)20-30(23-8-3-1-4-9-23)28(32)34-26-21-31(17-14-22(26)15-18-31)16-7-19-33-24-10-5-2-6-11-24/h1-6,8-13,22,26H,7,14-21H2/q+1/t22?,26-,31?/m0/s1 |
| InChIKey | OWCXZIGBHBWHOP-IMYXDSERSA-N |
| XLogP | 6.73 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.55 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|